ditert-butyl hydrogen phosphite


di-tert-butyl phosphite; ditert-butyl hydrogen phosphite
CAS RN:[13086-84-5]
Formula:C8H19O3P; 194.21 g/mol
InChiKey:RRJHOMPUEYYASJ-UHFFFAOYSA-N
SMILES:CC(C)(C)OP(O)OC(C)(C)C
Molecular structure of ditert-butyl hydrogen phosphite
Density:0.960 g/mL
Molar volume:202.3 mL/mol
Refractive index:1.420
Molecular refractive power:51.20 mL/mol

Isomers

tert-butyl phosphonate
Molecular structure of tert-butyl phosphonate
dibutyl hydrogen phosphite
Molecular structure of dibutyl hydrogen phosphite
ditert-butyl hydrogen phosphite
Molecular structure of ditert-butyl hydrogen phosphite
octylphosphonic acid
Molecular structure of octylphosphonic acid